C18H19NO2S2 — CID 44598734
(3aR,9aR)-9-(4-methylphenyl)sulfonyl-2,3,3a,9a-tetrahydro-1H-cyclopenta[b][1,4]benzothiazine (PubChem CID 44598734) has the molecular formula C18H19NO2S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (3aR,9aR)-9-(4-methylphenyl)sulfonyl-2,3,3a,9a-tetrahydro-1H-cyclopenta[b][1,4]benzothiazine.
| Compound Name | (3aR,9aR)-9-(4-methylphenyl)sulfonyl-2,3,3a,9a-tetrahydro-1H-cyclopenta[b][1,4]benzothiazine |
|---|---|
| PubChem CID | 44598734 |
| Molecular Formula | C18H19NO2S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (3aR,9aR)-9-(4-methylphenyl)sulfonyl-2,3,3a,9a-tetrahydro-1H-cyclopenta[b][1,4]benzothiazine |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3S[C@@H]3CCC[C@H]32)cc1 |
| InChI | InChI=1S/C18H19NO2S2/c1-13-9-11-14(12-10-13)23(20,21)19-15-5-2-3-7-17(15)22-18-8-4-6-16(18)19/h2-3,5,7,9-12,16,18H,4,6,8H2,1H3/t16-,18-/m1/s1 |
| InChIKey | NWXQJBVFGJNAHO-SJLPKXTDSA-N |
| XLogP | 4.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |