C20H20N2O2S — CID 132574425
(11S,15S)-10-(4-methylphenyl)sulfonyl-1,10-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,8-tetraene (PubChem CID 132574425) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is (11S,15S)-10-(4-methylphenyl)sulfonyl-1,10-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,8-tetraene.
| Compound Name | (11S,15S)-10-(4-methylphenyl)sulfonyl-1,10-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 132574425 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (11S,15S)-10-(4-methylphenyl)sulfonyl-1,10-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,8-tetraene |
| SMILES | Cc1ccc(S(=O)(=O)N2c3cc4ccccc4n3[C@H]3CCC[C@@H]32)cc1 |
| InChI | InChI=1S/C20H20N2O2S/c1-14-9-11-16(12-10-14)25(23,24)22-19-8-4-7-18(19)21-17-6-3-2-5-15(17)13-20(21)22/h2-3,5-6,9-13,18-19H,4,7-8H2,1H3/t18-,19-/m0/s1 |
| InChIKey | GQYLNJRSLSPGEN-OALUTQOASA-N |
| XLogP | 4.25 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |