C17H12N2O4S — CID 53320345
2-(4-methylphenyl)sulfonylimidazo[1,5-a]indole-1,3-dione (PubChem CID 53320345) has the molecular formula C17H12N2O4S and a molecular weight of 340.36 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonylimidazo[1,5-a]indole-1,3-dione.
| Compound Name | 2-(4-methylphenyl)sulfonylimidazo[1,5-a]indole-1,3-dione |
|---|---|
| PubChem CID | 53320345 |
| Molecular Formula | C17H12N2O4S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-(4-methylphenyl)sulfonylimidazo[1,5-a]indole-1,3-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)c3cc4ccccc4n3C2=O)cc1 |
| InChI | InChI=1S/C17H12N2O4S/c1-11-6-8-13(9-7-11)24(22,23)19-16(20)15-10-12-4-2-3-5-14(12)18(15)17(19)21/h2-10H,1H3 |
| InChIKey | FGUKGHGNGBQUMN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |