About 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione
2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione (PubChem CID 57340234) has the molecular formula C16H8Cl2N2O4S
and a molecular weight of 395.22 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione |
| PubChem CID | 57340234 |
| Molecular Formula | C16H8Cl2N2O4S |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione |
| SMILES | O=C1c2cc3ccccc3n2C(=O)N1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H8Cl2N2O4S/c17-11-6-5-10(8-12(11)18)25(23,24)20-15(21)14-7-9-3-1-2-4-13(9)19(14)16(20)22/h1-8H |
| InChIKey | FSHGBACDNFKATL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione?
The IUPAC name of 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione (CID 57340234) is 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione.
What is the SMILES notation for 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione?
The canonical SMILES for 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione is O=C1c2cc3ccccc3n2C(=O)N1S(=O)(=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione?
The InChIKey is FSHGBACDNFKATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8Cl2N2O4S/c17-11-6-5-10(8-12(11)18)25(23,24)20-15(21)14-7-9-3-1-2-4-13(9)19(14)16(20)22/h1-8H.
What are the key properties of 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione?
2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione has a molecular weight of 395.22 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)sulfonylimidazo[1,5-a]indole-1,3-dione is sourced from PubChem (CID 57340234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).