C15H8ClNO — CID 132518605
2-chloroindolo[1,2-a]indol-11-one (PubChem CID 132518605) has the molecular formula C15H8ClNO and a molecular weight of 253.69 g/mol. Its IUPAC name is 2-chloroindolo[1,2-a]indol-11-one.
| Compound Name | 2-chloroindolo[1,2-a]indol-11-one |
|---|---|
| PubChem CID | 132518605 |
| Molecular Formula | C15H8ClNO |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-chloroindolo[1,2-a]indol-11-one |
| SMILES | O=C1c2cc(Cl)ccc2-n2c1cc1ccccc12 |
| InChI | InChI=1S/C15H8ClNO/c16-10-5-6-13-11(8-10)15(18)14-7-9-3-1-2-4-12(9)17(13)14/h1-8H |
| InChIKey | LCNTWSUTQARPAU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |