C24H14Cl2N2O4 — CID 139227622
5-chloro-1-[[4-[(5-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl]indole-2,3-dione (PubChem CID 139227622) has the molecular formula C24H14Cl2N2O4 and a molecular weight of 465.29 g/mol. Its IUPAC name is 5-chloro-1-[[4-[(5-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[[4-[(5-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 139227622 |
| Molecular Formula | C24H14Cl2N2O4 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 5-chloro-1-[[4-[(5-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccc(CN3C(=O)C(=O)c4cc(Cl)ccc43)cc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H14Cl2N2O4/c25-15-5-7-19-17(9-15)21(29)23(31)27(19)11-13-1-2-14(4-3-13)12-28-20-8-6-16(26)10-18(20)22(30)24(28)32/h1-10H,11-12H2 |
| InChIKey | DPFGZEJTOCHANM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|