C14H16ClNO2 — CID 82928521
5-chloro-1-(2-ethylbutyl)indole-2,3-dione (PubChem CID 82928521) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is 5-chloro-1-(2-ethylbutyl)indole-2,3-dione.
| Compound Name | 5-chloro-1-(2-ethylbutyl)indole-2,3-dione |
|---|---|
| PubChem CID | 82928521 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-chloro-1-(2-ethylbutyl)indole-2,3-dione |
| SMILES | CCC(CC)CN1C(=O)C(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H16ClNO2/c1-3-9(4-2)8-16-12-6-5-10(15)7-11(12)13(17)14(16)18/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | RUUITFNZXUQKSQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|