C12H9Cl2NO2 — CID 77051425
5-chloro-1-(4-chlorobut-2-enyl)indole-2,3-dione (PubChem CID 77051425) has the molecular formula C12H9Cl2NO2 and a molecular weight of 270.12 g/mol. Its IUPAC name is 5-chloro-1-(4-chlorobut-2-enyl)indole-2,3-dione.
| Compound Name | 5-chloro-1-(4-chlorobut-2-enyl)indole-2,3-dione |
|---|---|
| PubChem CID | 77051425 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 5-chloro-1-(4-chlorobut-2-enyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CC=CCCl)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H9Cl2NO2/c13-5-1-2-6-15-10-4-3-8(14)7-9(10)11(16)12(15)17/h1-4,7H,5-6H2 |
| InChIKey | OSXFIXHNMHOIGQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|