C17H12Cl3NO3 — CID 9196252
5-chloro-1-[3-(2,4-dichlorophenoxy)propyl]indole-2,3-dione (PubChem CID 9196252) has the molecular formula C17H12Cl3NO3 and a molecular weight of 384.65 g/mol. Its IUPAC name is 5-chloro-1-[3-(2,4-dichlorophenoxy)propyl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[3-(2,4-dichlorophenoxy)propyl]indole-2,3-dione |
|---|---|
| PubChem CID | 9196252 |
| Molecular Formula | C17H12Cl3NO3 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 5-chloro-1-[3-(2,4-dichlorophenoxy)propyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCOc2ccc(Cl)cc2Cl)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H12Cl3NO3/c18-10-2-4-14-12(8-10)16(22)17(23)21(14)6-1-7-24-15-5-3-11(19)9-13(15)20/h2-5,8-9H,1,6-7H2 |
| InChIKey | QWCBSPZUCZKRRF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|