C13H13ClN2O2 — CID 103071645
5-chloro-1-[2-(methylaminomethyl)prop-2-enyl]indole-2,3-dione (PubChem CID 103071645) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 5-chloro-1-[2-(methylaminomethyl)prop-2-enyl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[2-(methylaminomethyl)prop-2-enyl]indole-2,3-dione |
|---|---|
| PubChem CID | 103071645 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 5-chloro-1-[2-(methylaminomethyl)prop-2-enyl]indole-2,3-dione |
| SMILES | C=C(CNC)CN1C(=O)C(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H13ClN2O2/c1-8(6-15-2)7-16-11-4-3-9(14)5-10(11)12(17)13(16)18/h3-5,15H,1,6-7H2,2H3 |
| InChIKey | LUGNWIRXFBRCNO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|