C13H12Cl2N2O2 — CID 106989741
4,7-dichloro-1-[2-(methylaminomethyl)prop-2-enyl]indole-2,3-dione (PubChem CID 106989741) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is 4,7-dichloro-1-[2-(methylaminomethyl)prop-2-enyl]indole-2,3-dione.
| Compound Name | 4,7-dichloro-1-[2-(methylaminomethyl)prop-2-enyl]indole-2,3-dione |
|---|---|
| PubChem CID | 106989741 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 4,7-dichloro-1-[2-(methylaminomethyl)prop-2-enyl]indole-2,3-dione |
| SMILES | C=C(CNC)CN1C(=O)C(=O)c2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C13H12Cl2N2O2/c1-7(5-16-2)6-17-11-9(15)4-3-8(14)10(11)12(18)13(17)19/h3-4,16H,1,5-6H2,2H3 |
| InChIKey | MISSAPMAOBWTMQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|