C12H10ClNO2 — CID 61355997
7-chloro-1-(2-methylprop-2-enyl)indole-2,3-dione (PubChem CID 61355997) has the molecular formula C12H10ClNO2 and a molecular weight of 235.67 g/mol. Its IUPAC name is 7-chloro-1-(2-methylprop-2-enyl)indole-2,3-dione.
| Compound Name | 7-chloro-1-(2-methylprop-2-enyl)indole-2,3-dione |
|---|---|
| PubChem CID | 61355997 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 7-chloro-1-(2-methylprop-2-enyl)indole-2,3-dione |
| SMILES | C=C(C)CN1C(=O)C(=O)c2cccc(Cl)c21 |
| InChI | InChI=1S/C12H10ClNO2/c1-7(2)6-14-10-8(11(15)12(14)16)4-3-5-9(10)13/h3-5H,1,6H2,2H3 |
| InChIKey | BPQPQTSTJJJEGA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|