C14H15Cl2NO2 — CID 106988640
4,7-dichloro-1-hexylindole-2,3-dione (PubChem CID 106988640) has the molecular formula C14H15Cl2NO2 and a molecular weight of 300.18 g/mol. Its IUPAC name is 4,7-dichloro-1-hexylindole-2,3-dione.
| Compound Name | 4,7-dichloro-1-hexylindole-2,3-dione |
|---|---|
| PubChem CID | 106988640 |
| Molecular Formula | C14H15Cl2NO2 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4,7-dichloro-1-hexylindole-2,3-dione |
| SMILES | CCCCCCN1C(=O)C(=O)c2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C14H15Cl2NO2/c1-2-3-4-5-8-17-12-10(16)7-6-9(15)11(12)13(18)14(17)19/h6-7H,2-5,8H2,1H3 |
| InChIKey | IIYXTHOUTAILRY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|