C13H11Cl2NO4 — CID 106988552
propan-2-yl 2-(4,7-dichloro-2,3-dioxoindol-1-yl)acetate (PubChem CID 106988552) has the molecular formula C13H11Cl2NO4 and a molecular weight of 316.14 g/mol. Its IUPAC name is propan-2-yl 2-(4,7-dichloro-2,3-dioxoindol-1-yl)acetate.
| Compound Name | propan-2-yl 2-(4,7-dichloro-2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 106988552 |
| Molecular Formula | C13H11Cl2NO4 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | propan-2-yl 2-(4,7-dichloro-2,3-dioxoindol-1-yl)acetate |
| SMILES | CC(C)OC(=O)CN1C(=O)C(=O)c2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C13H11Cl2NO4/c1-6(2)20-9(17)5-16-11-8(15)4-3-7(14)10(11)12(18)13(16)19/h3-4,6H,5H2,1-2H3 |
| InChIKey | VUMZHKOTWOKNTO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|