C14H14ClFN2O3 — CID 61360256
N-butan-2-yl-2-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)acetamide (PubChem CID 61360256) has the molecular formula C14H14ClFN2O3 and a molecular weight of 312.73 g/mol. Its IUPAC name is N-butan-2-yl-2-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)acetamide.
| Compound Name | N-butan-2-yl-2-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 61360256 |
| Molecular Formula | C14H14ClFN2O3 |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-butan-2-yl-2-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)acetamide |
| SMILES | CCC(C)NC(=O)CN1C(=O)C(=O)c2c(Cl)ccc(F)c21 |
| InChI | InChI=1S/C14H14ClFN2O3/c1-3-7(2)17-10(19)6-18-12-9(16)5-4-8(15)11(12)13(20)14(18)21/h4-5,7H,3,6H2,1-2H3,(H,17,19) |
| InChIKey | HJBOWNQRYSHEIY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|