C13H11ClFNO4 — CID 79629370
3-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylpropanoic acid (PubChem CID 79629370) has the molecular formula C13H11ClFNO4 and a molecular weight of 299.69 g/mol. Its IUPAC name is 3-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79629370 |
| Molecular Formula | C13H11ClFNO4 |
| Molecular Weight | 299.69 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CN1C(=O)C(=O)c2c(Cl)ccc(F)c21)C(=O)O |
| InChI | InChI=1S/C13H11ClFNO4/c1-13(2,12(19)20)5-16-9-7(15)4-3-6(14)8(9)10(17)11(16)18/h3-4H,5H2,1-2H3,(H,19,20) |
| InChIKey | BLSHCXFCZWEEKT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.69 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|