C14H11ClFNO4 — CID 77074373
methyl 4-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)-2-methylbut-2-enoate (PubChem CID 77074373) has the molecular formula C14H11ClFNO4 and a molecular weight of 311.70 g/mol. Its IUPAC name is methyl 4-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)-2-methylbut-2-enoate.
| Compound Name | methyl 4-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 77074373 |
| Molecular Formula | C14H11ClFNO4 |
| Molecular Weight | 311.70 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | methyl 4-(4-chloro-7-fluoro-2,3-dioxoindol-1-yl)-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCN1C(=O)C(=O)c2c(Cl)ccc(F)c21 |
| InChI | InChI=1S/C14H11ClFNO4/c1-7(14(20)21-2)5-6-17-11-9(16)4-3-8(15)10(11)12(18)13(17)19/h3-5H,6H2,1-2H3 |
| InChIKey | VTULDXNSNZSCNV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.70 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|