C14H15ClN2O3 — CID 61357562
N-butan-2-yl-2-(4-chloro-2,3-dioxoindol-1-yl)acetamide (PubChem CID 61357562) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is N-butan-2-yl-2-(4-chloro-2,3-dioxoindol-1-yl)acetamide.
| Compound Name | N-butan-2-yl-2-(4-chloro-2,3-dioxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 61357562 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-butan-2-yl-2-(4-chloro-2,3-dioxoindol-1-yl)acetamide |
| SMILES | CCC(C)NC(=O)CN1C(=O)C(=O)c2c(Cl)cccc21 |
| InChI | InChI=1S/C14H15ClN2O3/c1-3-8(2)16-11(18)7-17-10-6-4-5-9(15)12(10)13(19)14(17)20/h4-6,8H,3,7H2,1-2H3,(H,16,18) |
| InChIKey | UGPOWNMGQLWXGV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|