C11H8ClNO4 — CID 61359306
methyl 2-(4-chloro-2,3-dioxoindol-1-yl)acetate (PubChem CID 61359306) has the molecular formula C11H8ClNO4 and a molecular weight of 253.64 g/mol. Its IUPAC name is methyl 2-(4-chloro-2,3-dioxoindol-1-yl)acetate.
| Compound Name | methyl 2-(4-chloro-2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 61359306 |
| Molecular Formula | C11H8ClNO4 |
| Molecular Weight | 253.64 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | methyl 2-(4-chloro-2,3-dioxoindol-1-yl)acetate |
| SMILES | COC(=O)CN1C(=O)C(=O)c2c(Cl)cccc21 |
| InChI | InChI=1S/C11H8ClNO4/c1-17-8(14)5-13-7-4-2-3-6(12)9(7)10(15)11(13)16/h2-4H,5H2,1H3 |
| InChIKey | UVJWZOLCOKFLME-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.64 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|