C11H6Cl3NO2 — CID 106988691
4,7-dichloro-1-(2-chloroprop-2-enyl)indole-2,3-dione (PubChem CID 106988691) has the molecular formula C11H6Cl3NO2 and a molecular weight of 290.53 g/mol. Its IUPAC name is 4,7-dichloro-1-(2-chloroprop-2-enyl)indole-2,3-dione.
| Compound Name | 4,7-dichloro-1-(2-chloroprop-2-enyl)indole-2,3-dione |
|---|---|
| PubChem CID | 106988691 |
| Molecular Formula | C11H6Cl3NO2 |
| Molecular Weight | 290.53 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | 4,7-dichloro-1-(2-chloroprop-2-enyl)indole-2,3-dione |
| SMILES | C=C(Cl)CN1C(=O)C(=O)c2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C11H6Cl3NO2/c1-5(12)4-15-9-7(14)3-2-6(13)8(9)10(16)11(15)17/h2-3H,1,4H2 |
| InChIKey | MDHYQBMZMTWFAD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|