C12H7Cl2NO4 — CID 106988554
(E)-4-(4,7-dichloro-2,3-dioxoindol-1-yl)but-2-enoic acid (PubChem CID 106988554) has the molecular formula C12H7Cl2NO4 and a molecular weight of 300.10 g/mol. Its IUPAC name is (E)-4-(4,7-dichloro-2,3-dioxoindol-1-yl)but-2-enoic acid.
| Compound Name | (E)-4-(4,7-dichloro-2,3-dioxoindol-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 106988554 |
| Molecular Formula | C12H7Cl2NO4 |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | (E)-4-(4,7-dichloro-2,3-dioxoindol-1-yl)but-2-enoic acid |
| SMILES | O=C(O)/C=C/CN1C(=O)C(=O)c2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C12H7Cl2NO4/c13-6-3-4-7(14)10-9(6)11(18)12(19)15(10)5-1-2-8(16)17/h1-4H,5H2,(H,16,17)/b2-1+ |
| InChIKey | TYQZENHQFGOULX-OWOJBTEDSA-N |
| XLogP | 2.16 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|