C14H11Cl2NO4 — CID 106988580
ethyl (E)-4-(4,7-dichloro-2,3-dioxoindol-1-yl)but-2-enoate (PubChem CID 106988580) has the molecular formula C14H11Cl2NO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is ethyl (E)-4-(4,7-dichloro-2,3-dioxoindol-1-yl)but-2-enoate.
| Compound Name | ethyl (E)-4-(4,7-dichloro-2,3-dioxoindol-1-yl)but-2-enoate |
|---|---|
| PubChem CID | 106988580 |
| Molecular Formula | C14H11Cl2NO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | ethyl (E)-4-(4,7-dichloro-2,3-dioxoindol-1-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C/CN1C(=O)C(=O)c2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C14H11Cl2NO4/c1-2-21-10(18)4-3-7-17-12-9(16)6-5-8(15)11(12)13(19)14(17)20/h3-6H,2,7H2,1H3/b4-3+ |
| InChIKey | NRSJLWTXCNNFAD-ONEGZZNKSA-N |
| XLogP | 2.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|