C14H17NO3 — CID 113391006
ethyl (E)-4-(2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridin-1-yl)but-2-enoate (PubChem CID 113391006) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is ethyl (E)-4-(2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridin-1-yl)but-2-enoate.
| Compound Name | ethyl (E)-4-(2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridin-1-yl)but-2-enoate |
|---|---|
| PubChem CID | 113391006 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl (E)-4-(2-oxo-6,7-dihydro-5H-cyclopenta[b]pyridin-1-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C/Cn1c2c(ccc1=O)CCC2 |
| InChI | InChI=1S/C14H17NO3/c1-2-18-14(17)7-4-10-15-12-6-3-5-11(12)8-9-13(15)16/h4,7-9H,2-3,5-6,10H2,1H3/b7-4+ |
| InChIKey | LPZZZVUVXUWKAD-QPJJXVBHSA-N |
| XLogP | 1.46 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|