C13H19NO — CID 13169241
1-butyl-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 13169241) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-butyl-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 1-butyl-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 13169241 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-butyl-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | CCCCn1c2c(ccc1=O)CCCC2 |
| InChI | InChI=1S/C13H19NO/c1-2-3-10-14-12-7-5-4-6-11(12)8-9-13(14)15/h8-9H,2-7,10H2,1H3 |
| InChIKey | QWAHTNARSGSWPY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |