C12H18N2O — CID 118744521
6-(propan-2-ylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 118744521) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 6-(propan-2-ylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 6-(propan-2-ylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118744521 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 6-(propan-2-ylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | CC(C)NC1CCc2[nH]c(=O)ccc2C1 |
| InChI | InChI=1S/C12H18N2O/c1-8(2)13-10-4-5-11-9(7-10)3-6-12(15)14-11/h3,6,8,10,13H,4-5,7H2,1-2H3,(H,14,15) |
| InChIKey | PNGZMYLFBYXLCF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |