C10H14N2O — CID 81105195
5-amino-1-methyl-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 81105195) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 5-amino-1-methyl-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 5-amino-1-methyl-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 81105195 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 5-amino-1-methyl-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | Cn1c2c(ccc1=O)C(N)CCC2 |
| InChI | InChI=1S/C10H14N2O/c1-12-9-4-2-3-8(11)7(9)5-6-10(12)13/h5-6,8H,2-4,11H2,1H3 |
| InChIKey | ZYBBJQYYWSIZCD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |