C15H21N3O2 — CID 118739034
1-cyclopentyl-3-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-6-yl)urea (PubChem CID 118739034) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-6-yl)urea.
| Compound Name | 1-cyclopentyl-3-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-6-yl)urea |
|---|---|
| PubChem CID | 118739034 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-cyclopentyl-3-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-6-yl)urea |
| SMILES | O=C(NC1CCCC1)NC1CCc2[nH]c(=O)ccc2C1 |
| InChI | InChI=1S/C15H21N3O2/c19-14-8-5-10-9-12(6-7-13(10)18-14)17-15(20)16-11-3-1-2-4-11/h5,8,11-12H,1-4,6-7,9H2,(H,18,19)(H2,16,17,20) |
| InChIKey | ZQZKVABHRKXNPN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |