C12H10BrCl2NO2 — CID 106988596
1-(4-bromobutyl)-4,7-dichloroindole-2,3-dione (PubChem CID 106988596) has the molecular formula C12H10BrCl2NO2 and a molecular weight of 351.03 g/mol. Its IUPAC name is 1-(4-bromobutyl)-4,7-dichloroindole-2,3-dione.
| Compound Name | 1-(4-bromobutyl)-4,7-dichloroindole-2,3-dione |
|---|---|
| PubChem CID | 106988596 |
| Molecular Formula | C12H10BrCl2NO2 |
| Molecular Weight | 351.03 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | 1-(4-bromobutyl)-4,7-dichloroindole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCCBr)c2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C12H10BrCl2NO2/c13-5-1-2-6-16-10-8(15)4-3-7(14)9(10)11(17)12(16)18/h3-4H,1-2,5-6H2 |
| InChIKey | APSJAZNPPBTPHV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.03 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|