C22H12Cl4N2O3 — CID 150679382
2,4-dichloro-N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]benzamide (PubChem CID 150679382) has the molecular formula C22H12Cl4N2O3 and a molecular weight of 494.16 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 150679382 |
| Molecular Formula | C22H12Cl4N2O3 |
| Molecular Weight | 494.16 g/mol |
| Exact Mass | 491.96 |
| IUPAC Name | 2,4-dichloro-N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)C(=O)N2Cc1ccc(Cl)c(Cl)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H12Cl4N2O3/c23-12-2-4-14(17(25)8-12)21(30)27-13-3-6-19-15(9-13)20(29)22(31)28(19)10-11-1-5-16(24)18(26)7-11/h1-9H,10H2,(H,27,30) |
| InChIKey | JHNYTNDCXGIHKW-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.16 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|