C23H16Cl2N2O3 — CID 151435673
N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]-3-methylbenzamide (PubChem CID 151435673) has the molecular formula C23H16Cl2N2O3 and a molecular weight of 439.30 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]-3-methylbenzamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 151435673 |
| Molecular Formula | C23H16Cl2N2O3 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc3c(c2)C(=O)C(=O)N3Cc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C23H16Cl2N2O3/c1-13-3-2-4-15(9-13)22(29)26-16-6-8-20-17(11-16)21(28)23(30)27(20)12-14-5-7-18(24)19(25)10-14/h2-11H,12H2,1H3,(H,26,29) |
| InChIKey | PDLCXNGPNAAUBX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|