C15H9N3O4S — CID 53317841
4-(benzenesulfonyl)-2,4,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene-3,5-dione (PubChem CID 53317841) has the molecular formula C15H9N3O4S and a molecular weight of 327.32 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2,4,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene-3,5-dione.
| Compound Name | 4-(benzenesulfonyl)-2,4,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene-3,5-dione |
|---|---|
| PubChem CID | 53317841 |
| Molecular Formula | C15H9N3O4S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 4-(benzenesulfonyl)-2,4,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene-3,5-dione |
| SMILES | O=C1c2cc3cccnc3n2C(=O)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H9N3O4S/c19-14-12-9-10-5-4-8-16-13(10)17(12)15(20)18(14)23(21,22)11-6-2-1-3-7-11/h1-9H |
| InChIKey | TUEJROROMYGGOW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |