C12H8IN3O2S — CID 141293822
5-(benzenesulfonyl)-6-iodopyrrolo[2,3-b]pyrazine (PubChem CID 141293822) has the molecular formula C12H8IN3O2S and a molecular weight of 385.19 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-6-iodopyrrolo[2,3-b]pyrazine.
| Compound Name | 5-(benzenesulfonyl)-6-iodopyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 141293822 |
| Molecular Formula | C12H8IN3O2S |
| Molecular Weight | 385.19 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | 5-(benzenesulfonyl)-6-iodopyrrolo[2,3-b]pyrazine |
| SMILES | O=S(=O)(c1ccccc1)n1c(I)cc2nccnc21 |
| InChI | InChI=1S/C12H8IN3O2S/c13-11-8-10-12(15-7-6-14-10)16(11)19(17,18)9-4-2-1-3-5-9/h1-8H |
| InChIKey | GIMGJVPRGQBGTK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|