C20H14FIN2O3S — CID 90412233
1-(benzenesulfonyl)-4-(5-fluoro-2-methoxyphenyl)-2-iodopyrrolo[2,3-b]pyridine (PubChem CID 90412233) has the molecular formula C20H14FIN2O3S and a molecular weight of 508.31 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(5-fluoro-2-methoxyphenyl)-2-iodopyrrolo[2,3-b]pyridine.
| Compound Name | 1-(benzenesulfonyl)-4-(5-fluoro-2-methoxyphenyl)-2-iodopyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 90412233 |
| Molecular Formula | C20H14FIN2O3S |
| Molecular Weight | 508.31 g/mol |
| Exact Mass | 507.98 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(5-fluoro-2-methoxyphenyl)-2-iodopyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc(F)cc1-c1ccnc2c1cc(I)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H14FIN2O3S/c1-27-18-8-7-13(21)11-16(18)15-9-10-23-20-17(15)12-19(22)24(20)28(25,26)14-5-3-2-4-6-14/h2-12H,1H3 |
| InChIKey | MYBPVNUECGQHIS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|