C14H10BrIN2O2S — CID 121228709
1-(benzenesulfonyl)-5-bromo-2-iodo-4-methylpyrrolo[2,3-b]pyridine (PubChem CID 121228709) has the molecular formula C14H10BrIN2O2S and a molecular weight of 477.12 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-bromo-2-iodo-4-methylpyrrolo[2,3-b]pyridine.
| Compound Name | 1-(benzenesulfonyl)-5-bromo-2-iodo-4-methylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 121228709 |
| Molecular Formula | C14H10BrIN2O2S |
| Molecular Weight | 477.12 g/mol |
| Exact Mass | 475.87 |
| IUPAC Name | 1-(benzenesulfonyl)-5-bromo-2-iodo-4-methylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1c(Br)cnc2c1cc(I)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H10BrIN2O2S/c1-9-11-7-13(16)18(14(11)17-8-12(9)15)21(19,20)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | PZXWDPYHLFKHOV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.12 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|