C13H8FIN2O2S — CID 123134965
1-(benzenesulfonyl)-6-fluoro-2-iodopyrrolo[3,2-b]pyridine (PubChem CID 123134965) has the molecular formula C13H8FIN2O2S and a molecular weight of 402.19 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-fluoro-2-iodopyrrolo[3,2-b]pyridine.
| Compound Name | 1-(benzenesulfonyl)-6-fluoro-2-iodopyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 123134965 |
| Molecular Formula | C13H8FIN2O2S |
| Molecular Weight | 402.19 g/mol |
| Exact Mass | 401.93 |
| IUPAC Name | 1-(benzenesulfonyl)-6-fluoro-2-iodopyrrolo[3,2-b]pyridine |
| SMILES | O=S(=O)(c1ccccc1)n1c(I)cc2ncc(F)cc21 |
| InChI | InChI=1S/C13H8FIN2O2S/c14-9-6-12-11(16-8-9)7-13(15)17(12)20(18,19)10-4-2-1-3-5-10/h1-8H |
| InChIKey | RWAKNLRUGMGOER-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|