C10H7Br2NO2S — CID 71523732
1-(benzenesulfonyl)-2,5-dibromopyrrole (PubChem CID 71523732) has the molecular formula C10H7Br2NO2S and a molecular weight of 365.05 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2,5-dibromopyrrole.
| Compound Name | 1-(benzenesulfonyl)-2,5-dibromopyrrole |
|---|---|
| PubChem CID | 71523732 |
| Molecular Formula | C10H7Br2NO2S |
| Molecular Weight | 365.05 g/mol |
| Exact Mass | 362.86 |
| IUPAC Name | 1-(benzenesulfonyl)-2,5-dibromopyrrole |
| SMILES | O=S(=O)(c1ccccc1)n1c(Br)ccc1Br |
| InChI | InChI=1S/C10H7Br2NO2S/c11-9-6-7-10(12)13(9)16(14,15)8-4-2-1-3-5-8/h1-7H |
| InChIKey | IUYWHVIPZMHGAB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.05 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |