C16H13Cl2NO2S — CID 10428188
1-(benzenesulfonyl)-2,3-bis(chloromethyl)indole (PubChem CID 10428188) has the molecular formula C16H13Cl2NO2S and a molecular weight of 354.26 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2,3-bis(chloromethyl)indole.
| Compound Name | 1-(benzenesulfonyl)-2,3-bis(chloromethyl)indole |
|---|---|
| PubChem CID | 10428188 |
| Molecular Formula | C16H13Cl2NO2S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 1-(benzenesulfonyl)-2,3-bis(chloromethyl)indole |
| SMILES | O=S(=O)(c1ccccc1)n1c(CCl)c(CCl)c2ccccc21 |
| InChI | InChI=1S/C16H13Cl2NO2S/c17-10-14-13-8-4-5-9-15(13)19(16(14)11-18)22(20,21)12-6-2-1-3-7-12/h1-9H,10-11H2 |
| InChIKey | VDMPZEKZFONXDG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|