C15H10ClNO6S2 — CID 87784362
1-(benzenesulfonyl)-3-chlorosulfonylindole-2-carboxylic acid (PubChem CID 87784362) has the molecular formula C15H10ClNO6S2 and a molecular weight of 399.83 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-chlorosulfonylindole-2-carboxylic acid.
| Compound Name | 1-(benzenesulfonyl)-3-chlorosulfonylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 87784362 |
| Molecular Formula | C15H10ClNO6S2 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | 1-(benzenesulfonyl)-3-chlorosulfonylindole-2-carboxylic acid |
| SMILES | O=C(O)c1c(S(=O)(=O)Cl)c2ccccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H10ClNO6S2/c16-24(20,21)14-11-8-4-5-9-12(11)17(13(14)15(18)19)25(22,23)10-6-2-1-3-7-10/h1-9H,(H,18,19) |
| InChIKey | MWVCXSPNNDAHIM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |