C22H17NO5S — CID 143599939
1-(benzenesulfonyl)-2-[hydroxy(phenyl)methyl]indole-3-carboxylic acid (PubChem CID 143599939) has the molecular formula C22H17NO5S and a molecular weight of 407.45 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-[hydroxy(phenyl)methyl]indole-3-carboxylic acid.
| Compound Name | 1-(benzenesulfonyl)-2-[hydroxy(phenyl)methyl]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 143599939 |
| Molecular Formula | C22H17NO5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 1-(benzenesulfonyl)-2-[hydroxy(phenyl)methyl]indole-3-carboxylic acid |
| SMILES | O=C(O)c1c(C(O)c2ccccc2)n(S(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C22H17NO5S/c24-21(15-9-3-1-4-10-15)20-19(22(25)26)17-13-7-8-14-18(17)23(20)29(27,28)16-11-5-2-6-12-16/h1-14,21,24H,(H,25,26) |
| InChIKey | MNVHWQNZKCBSDB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |