C22H23NO4S — CID 102109918
(2S)-2-[(R)-[1-(benzenesulfonyl)-2-methylindol-3-yl]-hydroxymethyl]cyclohexan-1-one (PubChem CID 102109918) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is (2S)-2-[(R)-[1-(benzenesulfonyl)-2-methylindol-3-yl]-hydroxymethyl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(R)-[1-(benzenesulfonyl)-2-methylindol-3-yl]-hydroxymethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102109918 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (2S)-2-[(R)-[1-(benzenesulfonyl)-2-methylindol-3-yl]-hydroxymethyl]cyclohexan-1-one |
| SMILES | Cc1c([C@H](O)[C@@H]2CCCCC2=O)c2ccccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23NO4S/c1-15-21(22(25)18-12-6-8-14-20(18)24)17-11-5-7-13-19(17)23(15)28(26,27)16-9-3-2-4-10-16/h2-5,7,9-11,13,18,22,25H,6,8,12,14H2,1H3/t18-,22-/m1/s1 |
| InChIKey | ZMWPPTRLFBPLNU-XMSQKQJNSA-N |
| XLogP | 3.98 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |