C19H20N2O2S — CID 58147103
6-(benzenesulfonyl)-2-methyl-1,3,4,5-tetrahydroazepino[4,3-b]indole (PubChem CID 58147103) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-2-methyl-1,3,4,5-tetrahydroazepino[4,3-b]indole.
| Compound Name | 6-(benzenesulfonyl)-2-methyl-1,3,4,5-tetrahydroazepino[4,3-b]indole |
|---|---|
| PubChem CID | 58147103 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 6-(benzenesulfonyl)-2-methyl-1,3,4,5-tetrahydroazepino[4,3-b]indole |
| SMILES | CN1CCCc2c(c3ccccc3n2S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C19H20N2O2S/c1-20-13-7-12-19-17(14-20)16-10-5-6-11-18(16)21(19)24(22,23)15-8-3-2-4-9-15/h2-6,8-11H,7,12-14H2,1H3 |
| InChIKey | WPZALLUVUYUUML-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |