About 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole
5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 126571284) has the molecular formula C14H18N2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| PubChem CID | 126571284 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | CCn1c2c(c3ccccc31)CN(C)CC2 |
| InChI | InChI=1S/C14H18N2/c1-3-16-13-7-5-4-6-11(13)12-10-15(2)9-8-14(12)16/h4-7H,3,8-10H2,1-2H3 |
| InChIKey | MQMPBUZBXSXOML-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole?
The IUPAC name of 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole (CID 126571284) is 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
What is the SMILES notation for 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole?
The canonical SMILES for 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole is CCn1c2c(c3ccccc31)CN(C)CC2.
What is the InChIKey of 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole?
The InChIKey is MQMPBUZBXSXOML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2/c1-3-16-13-7-5-4-6-11(13)12-10-15(2)9-8-14(12)16/h4-7H,3,8-10H2,1-2H3.
What are the key properties of 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole?
5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole has a molecular weight of 214.31 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole is sourced from PubChem (CID 126571284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).