C25H22N2O5S2 — CID 138982150
2,9-bis-(4-methylphenyl)sulfonyl-1,3-dihydropyrido[3,4-b]indol-4-one (PubChem CID 138982150) has the molecular formula C25H22N2O5S2 and a molecular weight of 494.59 g/mol. Its IUPAC name is 2,9-bis-(4-methylphenyl)sulfonyl-1,3-dihydropyrido[3,4-b]indol-4-one.
| Compound Name | 2,9-bis-(4-methylphenyl)sulfonyl-1,3-dihydropyrido[3,4-b]indol-4-one |
|---|---|
| PubChem CID | 138982150 |
| Molecular Formula | C25H22N2O5S2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 2,9-bis-(4-methylphenyl)sulfonyl-1,3-dihydropyrido[3,4-b]indol-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(=O)c3c(n(S(=O)(=O)c4ccc(C)cc4)c4ccccc34)C2)cc1 |
| InChI | InChI=1S/C25H22N2O5S2/c1-17-7-11-19(12-8-17)33(29,30)26-15-23-25(24(28)16-26)21-5-3-4-6-22(21)27(23)34(31,32)20-13-9-18(2)10-14-20/h3-14H,15-16H2,1-2H3 |
| InChIKey | RBVXIMQHXSRXPS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |