C18H18N2O2S — CID 134957407
4-methyl-3-(4-methylphenyl)sulfonyl-1,2-dihydropyrrolo[2,3-b]indole (PubChem CID 134957407) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-methyl-3-(4-methylphenyl)sulfonyl-1,2-dihydropyrrolo[2,3-b]indole.
| Compound Name | 4-methyl-3-(4-methylphenyl)sulfonyl-1,2-dihydropyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 134957407 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-methyl-3-(4-methylphenyl)sulfonyl-1,2-dihydropyrrolo[2,3-b]indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3c2n(C)c2ccccc32)cc1 |
| InChI | InChI=1S/C18H18N2O2S/c1-13-7-9-14(10-8-13)23(21,22)20-12-11-16-15-5-3-4-6-17(15)19(2)18(16)20/h3-10H,11-12H2,1-2H3 |
| InChIKey | HUGDGINTAOMXHL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |