C20H18N2O3S — CID 102516278
4,9-dimethyl-2-(4-methylphenyl)sulfonylpyrido[3,4-b]indol-1-one (PubChem CID 102516278) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 4,9-dimethyl-2-(4-methylphenyl)sulfonylpyrido[3,4-b]indol-1-one.
| Compound Name | 4,9-dimethyl-2-(4-methylphenyl)sulfonylpyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 102516278 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4,9-dimethyl-2-(4-methylphenyl)sulfonylpyrido[3,4-b]indol-1-one |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C)c3c4ccccc4n(C)c3c2=O)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c1-13-8-10-15(11-9-13)26(24,25)22-12-14(2)18-16-6-4-5-7-17(16)21(3)19(18)20(22)23/h4-12H,1-3H3 |
| InChIKey | BHTMQUNQZXWOSB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |