C20H19ClN2O2S — CID 132608563
1-(4-chlorophenyl)sulfonyl-4,10-dimethyl-2,5-dihydroazepino[2,3-b]indole (PubChem CID 132608563) has the molecular formula C20H19ClN2O2S and a molecular weight of 386.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4,10-dimethyl-2,5-dihydroazepino[2,3-b]indole.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4,10-dimethyl-2,5-dihydroazepino[2,3-b]indole |
|---|---|
| PubChem CID | 132608563 |
| Molecular Formula | C20H19ClN2O2S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4,10-dimethyl-2,5-dihydroazepino[2,3-b]indole |
| SMILES | CC1=CCN(S(=O)(=O)c2ccc(Cl)cc2)c2c(c3ccccc3n2C)C1 |
| InChI | InChI=1S/C20H19ClN2O2S/c1-14-11-12-23(26(24,25)16-9-7-15(21)8-10-16)20-18(13-14)17-5-3-4-6-19(17)22(20)2/h3-11H,12-13H2,1-2H3 |
| InChIKey | KZKARKWDRXFNDR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|