C20H22N2O3S — CID 113090014
2-(4-methoxy-3-methylphenyl)sulfonyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole (PubChem CID 113090014) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-(4-methoxy-3-methylphenyl)sulfonyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole.
| Compound Name | 2-(4-methoxy-3-methylphenyl)sulfonyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 113090014 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-(4-methoxy-3-methylphenyl)sulfonyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
| SMILES | COc1ccc(S(=O)(=O)N2CCc3c(n(C)c4ccccc34)C2)cc1C |
| InChI | InChI=1S/C20H22N2O3S/c1-14-12-15(8-9-20(14)25-3)26(23,24)22-11-10-17-16-6-4-5-7-18(16)21(2)19(17)13-22/h4-9,12H,10-11,13H2,1-3H3 |
| InChIKey | PRDHGTAVSPWAHS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|