C23H17NO4S — CID 132577368
7-(4-methylphenyl)sulfonyl-5,6-dihydrobenzo[c]carbazole-1,4-dione (PubChem CID 132577368) has the molecular formula C23H17NO4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 7-(4-methylphenyl)sulfonyl-5,6-dihydrobenzo[c]carbazole-1,4-dione.
| Compound Name | 7-(4-methylphenyl)sulfonyl-5,6-dihydrobenzo[c]carbazole-1,4-dione |
|---|---|
| PubChem CID | 132577368 |
| Molecular Formula | C23H17NO4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 7-(4-methylphenyl)sulfonyl-5,6-dihydrobenzo[c]carbazole-1,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)n2c3c(c4ccccc42)C2=C(CC3)C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C23H17NO4S/c1-14-6-8-15(9-7-14)29(27,28)24-18-5-3-2-4-16(18)22-19(24)11-10-17-20(25)12-13-21(26)23(17)22/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | CPHZBJLNWZIODL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 73.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|