C21H25NO4S — CID 10620251
2-(diethoxymethyl)-3-methyl-1-(4-methylphenyl)sulfonylindole (PubChem CID 10620251) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is 2-(diethoxymethyl)-3-methyl-1-(4-methylphenyl)sulfonylindole.
| Compound Name | 2-(diethoxymethyl)-3-methyl-1-(4-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 10620251 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-(diethoxymethyl)-3-methyl-1-(4-methylphenyl)sulfonylindole |
| SMILES | CCOC(OCC)c1c(C)c2ccccc2n1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-5-25-21(26-6-2)20-16(4)18-9-7-8-10-19(18)22(20)27(23,24)17-13-11-15(3)12-14-17/h7-14,21H,5-6H2,1-4H3 |
| InChIKey | GRBZGXMNPMUJFW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|