C27H23NO4S — CID 132598521
ethyl 6-methyl-11-(4-methylphenyl)sulfonylbenzo[a]carbazole-5-carboxylate (PubChem CID 132598521) has the molecular formula C27H23NO4S and a molecular weight of 457.55 g/mol. Its IUPAC name is ethyl 6-methyl-11-(4-methylphenyl)sulfonylbenzo[a]carbazole-5-carboxylate.
| Compound Name | ethyl 6-methyl-11-(4-methylphenyl)sulfonylbenzo[a]carbazole-5-carboxylate |
|---|---|
| PubChem CID | 132598521 |
| Molecular Formula | C27H23NO4S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | ethyl 6-methyl-11-(4-methylphenyl)sulfonylbenzo[a]carbazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)c2c3ccccc3n(S(=O)(=O)c3ccc(C)cc3)c2c2ccccc12 |
| InChI | InChI=1S/C27H23NO4S/c1-4-32-27(29)25-18(3)24-22-11-7-8-12-23(22)28(26(24)21-10-6-5-9-20(21)25)33(30,31)19-15-13-17(2)14-16-19/h5-16H,4H2,1-3H3 |
| InChIKey | QXDGMHDIRJSDKL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |